![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 2Gs-BBQ/ | 2026-06-25 15:44 | - | |
| Alice's Country House/ | 2026-10-08 11:25 | - | |
| All American Diner/ | 2026-06-02 09:22 | - | |
| Amigo Family Mexican/ | 2026-07-11 13:10 | - | |
| Angelo's/ | 2026-08-05 08:50 | - | |
| Angelo's Mediterrane..> | 2026-08-04 12:23 | - | |
| Angelo's Pizza/ | 2026-04-10 11:51 | - | |
| Beacon 443/ | 2025-10-10 12:48 | - | |
| Bear's Restaurant/ | 2026-09-04 09:39 | - | |
| Bedillon's/ | 2026-08-15 12:36 | - | |
| Big Bear Brewing Co./ | 2026-03-09 12:12 | - | |
| Big Bear Po-Boys/ | 2025-01-27 12:43 | - | |
| Billy's Bar and Grill/ | 2025-05-16 09:24 | - | |
| Bodacious Bar-B-Q/ | 2026-03-27 09:35 | - | |
| Brandis Kitchen and ..> | 2025-05-08 12:54 | - | |
| Breakwater Seafoods ..> | 2026-08-01 11:16 | - | |
| Bubba's Fat Burgers/ | 2025-12-10 08:43 | - | |
| Burrito King Souvenir/ | 2025-10-16 10:15 | - | |
| Cackle & Oink BBQ/ | 2026-10-09 07:42 | - | |
| Cancun Mexican Resta..> | 2025-12-18 11:33 | - | |
| Capizzi's Italian Ki..> | 2026-05-21 08:50 | - | |
| Captain Anderson/ | 2026-03-02 10:22 | - | |
| Carrera's Authentic ..> | 2025-08-26 08:39 | - | |
| Casa Romo Cocina/ | 2026-08-29 06:28 | - | |
| Charlie Horse/ | 2026-08-07 11:57 | - | |
| City Diner/ | 2026-08-01 11:45 | - | |
| Clancy's/ | 2020-01-29 06:53 | - | |
| Clancy's at the Barn/ | 2025-08-13 11:10 | - | |
| Coopers Cookin and C..> | 2026-08-07 11:47 | - | |
| Countrie Eatery/ | 2026-05-01 09:43 | - | |
| Country Folks Deli/ | 2026-08-01 11:54 | - | |
| Cucci's Pizzeria/ | 2025-12-11 09:30 | - | |
| Dattilos/ | 2025-12-02 09:55 | - | |
| Dexter's Pub/ | 2026-09-04 09:20 | - | |
| Ding Dong Cafe/ | 2025-11-04 12:47 | - | |
| Dinner Bell McComb/ | 2026-07-17 09:07 | - | |
| Do-B's/ | 2026-01-30 08:48 | - | |
| Doug's Classic '57/ | 2026-06-18 12:57 | - | |
| Eastside Restaurant/ | 2024-12-09 12:15 | - | |
| El Ranchito/ | 2025-10-31 12:09 | - | |
| El Rancho/ | 2025-11-14 11:43 | - | |
| El Rancho Ponchatoula/ | 2026-06-26 08:23 | - | |
| El Torito/ | 2025-07-01 12:44 | - | |
| Fish House/ | 2026-01-13 07:04 | - | |
| Fishlips Waterfront ..> | 2026-08-15 12:50 | - | |
| Full Plate/ | 2025-10-30 11:42 | - | |
| Genaro's/ | 2026-02-03 09:28 | - | |
| Gordy's Pizza & Pasta/ | 2026-02-24 12:56 | - | |
| Granny's Kitchen/ | 2026-04-02 09:02 | - | |
| Greek Village/ | 2025-12-03 13:26 | - | |
| Guacamole Brothers/ | 2026-03-04 12:16 | - | |
| Guadalajara Family M..> | 2026-02-24 12:44 | - | |
| Harvest Family Resta..> | 2026-03-19 11:17 | - | |
| Hideaway Pizza/ | 2026-01-09 13:21 | - | |
| House of Beef/ | 2026-07-11 13:23 | - | |
| Hungry Peddler/ | 2026-01-20 07:55 | - | |
| Hurricane Alley/ | 2025-10-20 12:00 | - | |
| Illiano Cucina/ | 2026-06-15 10:11 | - | |
| It's About Thyme/ | 2021-10-13 09:42 | - | |
| Italian Village/ | 2024-06-04 08:03 | - | |
| J.W. Filmore's/ | 2026-08-04 11:54 | - | |
| Javier's Mexican/ | 2026-08-06 09:52 | - | |
| Jim Bob's Chuckwagon..> | 2026-07-02 12:25 | - | |
| Joe Boccardi's Colum..> | 2026-01-23 12:41 | - | |
| JohnnyMacs Bar and G..> | 2026-06-26 08:32 | - | |
| Johnny Q's/ | 2022-08-03 09:46 | - | |
| Jolly Rogers/ | 2026-09-19 07:55 | - | |
| Joy Teriyaki/ | 2026-08-05 09:19 | - | |
| Juan's Flaming Fajit..> | 2026-07-11 13:03 | - | |
| La Cascada Mexican/ | 2025-11-12 11:34 | - | |
| Lazy Days/ | 2026-06-02 08:39 | - | |
| Lazy Days South/ | 2026-10-10 11:19 | - | |
| Lil-Tex/ | 2026-06-02 09:02 | - | |
| Longstreet Cafe/ | 2026-01-21 08:37 | - | |
| Los Domingo's (Apple..> | 2026-10-09 07:54 | - | |
| Los Domingo's (Barst..> | 2026-06-12 07:54 | - | |
| Los Palominos/ | 2026-10-08 11:13 | - | |
| Los Pepe's/ | 2026-01-15 12:31 | - | |
| Market Grill/ | 2026-08-05 09:30 | - | |
| Mata's Greek Pizza/ | 2026-08-20 07:47 | - | |
| McLean's Ole Time Cafe/ | 2025-10-24 12:08 | - | |
| Mexico Lindo/ | 2026-03-04 12:01 | - | |
| Michael's Kitchen/ | 2026-01-05 12:44 | - | |
| Midway Oh Boy/ | 2026-03-13 08:40 | - | |
| Mineral Restaurant/ | 2026-05-01 09:26 | - | |
| Mis Padres Mexican/ | 2026-06-23 08:47 | - | |
| Molly Goodheads/ | 2026-02-13 12:48 | - | |
| Muddbones/ | 2026-08-06 08:21 | - | |
| Mumphords Place BBQ/ | 2026-05-22 08:27 | - | |
| My Place/ | 2025-02-24 12:56 | - | |
| Naples Spaghetti House/ | 2026-06-02 09:31 | - | |
| Noah's Ark Restaurant/ | 2026-06-26 08:14 | - | |
| OnlineMenus/ | 2026-06-19 07:40 | - | |
| Ottavio's Italian/ | 2026-06-12 12:35 | - | |
| PT's Eat-A-Bite/ | 2026-08-05 10:31 | - | |
| Papa's Pizza/ | 2026-06-19 08:28 | - | |
| Papa's Pizzeria/ | 2026-04-24 11:32 | - | |
| Papa Poblano's/ | 2026-03-05 09:36 | - | |
| Pepper's Grill & Bar/ | 2025-11-12 10:38 | - | |
| Pit Boss Bar-B-Q/ | 2025-11-06 07:24 | - | |
| Pit Stop BBQ/ | 2026-04-23 07:44 | - | |
| PitStop Bar-B-Que/ | 2025-12-02 09:14 | - | |
| Pizza Connection/ | 2025-01-23 10:50 | - | |
| Plains Trading Post/ | 2026-04-24 11:54 | - | |
| Portofino Italian/ | 2026-07-11 12:42 | - | |
| Ranch House Grill/ | 2026-10-10 11:14 | - | |
| Randazzo's/ | 2025-11-19 11:43 | - | |
| Richie Z's BBQ & Grill/ | 2025-10-01 10:24 | - | |
| Riverside Cafe on th..> | 2026-08-06 07:54 | - | |
| Roger's Pizza/ | 2026-06-26 07:42 | - | |
| Romy's Restaurant/ | 2025-09-24 15:49 | - | |
| Rossini's Pizza/ | 2026-09-12 07:54 | - | |
| Rutherford's66Family..> | 2026-05-01 10:00 | - | |
| Rutherford's 66 Fami..> | 2026-09-19 07:45 | - | |
| Salty Joe's BBQ Shop/ | 2026-07-29 09:53 | - | |
| Sara's Place/ | 2025-05-05 07:56 | - | |
| Sarah's on the Square/ | 2024-05-07 14:25 | - | |
| Scarpino's Family Re..> | 2025-06-25 08:00 | - | |
| Schnitzelbank/ | 2025-09-03 12:55 | - | |
| Shelly's Cafe/ | 2026-07-11 13:16 | - | |
| Shep's/ | 2026-03-05 12:29 | - | |
| Shiloh's/ | 2025-10-07 12:45 | - | |
| Smokin Pig BBQ/ | 2026-04-07 08:30 | - | |
| Smokin Q/ | 2026-04-17 12:35 | - | |
| Sombreros Mexican Re..> | 2025-04-04 11:21 | - | |
| Sombreros Mexican Re..> | 2026-03-13 08:20 | - | |
| Speekezzies Cafe and..> | 2026-02-17 11:00 | - | |
| Spiro's Pizza & Pasta/ | 2026-08-05 09:03 | - | |
| Spruce Goose Cafe/ | 2026-07-15 09:12 | - | |
| Stefanina's (O'Fallon)/ | 2026-04-13 09:51 | - | |
| Sweet Inspirations/ | 2026-10-10 11:09 | - | |
| The Breakfast Place/ | 2026-06-05 11:48 | - | |
| The Juicy Seafood/ | 2026-07-02 12:15 | - | |
| Tim's II/ | 2026-09-12 10:48 | - | |
| Tim's at Lake Anna/ | 2026-06-26 07:51 | - | |
| Tin Roof/ | 2026-04-15 08:24 | - | |
| Tomaso's/ | 2026-06-19 08:01 | - | |
| Tommaso's/ | 2026-08-29 06:01 | - | |
| Trotter's/ | 2024-12-06 14:27 | - | |
| Twede's Cafe/ | 2026-04-20 11:29 | - | |
| Two Cousins Italian/ | 2026-07-02 12:06 | - | |
| Two Georges Dockside..> | 2026-04-21 12:10 | - | |
| Two Georges Waterfro..> | 2025-09-19 09:51 | - | |
| Union Grill/ | 2026-03-13 11:59 | - | |
| Vicky's Bar-B-Q/ | 2026-09-15 11:31 | - | |
| Waffles N More/ | 2025-10-07 12:04 | - | |
| Waterfront Grille/ | 2026-06-12 12:18 | - | |
| Wayne's Corner Cafe/ | 2025-12-19 10:30 | - | |
| Westwood Restaurant ..> | 2026-06-19 08:09 | - | |